About 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid
1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid (PubChem CID 43523000) has the molecular formula C9H8O4S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid |
| PubChem CID | 43523000 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8O4S/c10-9(11)7-5-14(12,13)8-4-2-1-3-6(7)8/h1-4,7H,5H2,(H,10,11) |
| InChIKey | MSSQWPDYTYWFCS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid (CID 43523000) is 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid is O=C(O)C1CS(=O)(=O)c2ccccc21.
What is the InChIKey of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is MSSQWPDYTYWFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4S/c10-9(11)7-5-14(12,13)8-4-2-1-3-6(7)8/h1-4,7H,5H2,(H,10,11).
What are the key properties of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid?
1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 212.23 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 43523000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).