C13H15N3 — CID 43524021
3-N-(1-pyridin-4-ylethyl)benzene-1,3-diamine (PubChem CID 43524021) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-N-(1-pyridin-4-ylethyl)benzene-1,3-diamine.
| Compound Name | 3-N-(1-pyridin-4-ylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 43524021 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 3-N-(1-pyridin-4-ylethyl)benzene-1,3-diamine |
| SMILES | CC(Nc1cccc(N)c1)c1ccncc1 |
| InChI | InChI=1S/C13H15N3/c1-10(11-5-7-15-8-6-11)16-13-4-2-3-12(14)9-13/h2-10,16H,14H2,1H3 |
| InChIKey | WPJTXXUABPXNGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|