C11H13IN4 — CID 43524797
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-iodoaniline (PubChem CID 43524797) has the molecular formula C11H13IN4 and a molecular weight of 328.16 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-iodoaniline.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 43524797 |
| Molecular Formula | C11H13IN4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-iodoaniline |
| SMILES | Cc1nnc(CNc2cccc(I)c2)n1C |
| InChI | InChI=1S/C11H13IN4/c1-8-14-15-11(16(8)2)7-13-10-5-3-4-9(12)6-10/h3-6,13H,7H2,1-2H3 |
| InChIKey | JBEVTUSMGMKLTJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|