C12H13F3N4S — CID 43524885
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylsulfanyl]-5-(trifluoromethyl)aniline (PubChem CID 43524885) has the molecular formula C12H13F3N4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylsulfanyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylsulfanyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43524885 |
| Molecular Formula | C12H13F3N4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylsulfanyl]-5-(trifluoromethyl)aniline |
| SMILES | Cc1nnc(CSc2ccc(C(F)(F)F)cc2N)n1C |
| InChI | InChI=1S/C12H13F3N4S/c1-7-17-18-11(19(7)2)6-20-10-4-3-8(5-9(10)16)12(13,14)15/h3-5H,6,16H2,1-2H3 |
| InChIKey | ZKKYUPIBSQZBCF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|