2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid

C8H14N4O2 — CID 43524944

IUPAC2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid
SMILESCc1nnc(CNC(C)C(=O)O)n1C
InChIInChI=1S/C8H14N4O2/c1-5(8(13)14)9-4-7-11-10-6(2)12(7)3/h5,9H,4H2,1-3H3,(H,13,14)
InChIKeyRXWNGOQQHIHDCT-UHFFFAOYSA-N
MW198.23 g/mol
LogP-0.31
Rot. Bonds4

About 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid

2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid (PubChem CID 43524944) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid.

Molecular Properties

Compound Name2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid
PubChem CID43524944
Molecular FormulaC8H14N4O2
Molecular Weight198.23 g/mol
Exact Mass198.11
IUPAC Name2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid
SMILESCc1nnc(CNC(C)C(=O)O)n1C
InChIInChI=1S/C8H14N4O2/c1-5(8(13)14)9-4-7-11-10-6(2)12(7)3/h5,9H,4H2,1-3H3,(H,13,14)
InChIKeyRXWNGOQQHIHDCT-UHFFFAOYSA-N
XLogP-0.31
TPSA80.04 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.23
LogP ≤ 5-0.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid?
The IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid (CID 43524944) is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid.
What is the SMILES notation for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid?
The canonical SMILES for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid is Cc1nnc(CNC(C)C(=O)O)n1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid?
The InChIKey is RXWNGOQQHIHDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-5(8(13)14)9-4-7-11-10-6(2)12(7)3/h5,9H,4H2,1-3H3,(H,13,14).
What are the key properties of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid?
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid has a molecular weight of 198.23 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methylamino]propanoic acid is sourced from PubChem (CID 43524944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).