About 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine
4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 43528044) has the molecular formula C13H13F3N2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| PubChem CID | 43528044 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CN(Cc1ccsc1)c1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2S/c1-18(7-9-4-5-19-8-9)10-2-3-12(17)11(6-10)13(14,15)16/h2-6,8H,7,17H2,1H3 |
| InChIKey | IOJSMPIWQMTPQL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The IUPAC name of 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine (CID 43528044) is 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine.
What is the SMILES notation for 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The canonical SMILES for 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine is CN(Cc1ccsc1)c1ccc(N)c(C(F)(F)F)c1.
What is the InChIKey of 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine?
The InChIKey is IOJSMPIWQMTPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2S/c1-18(7-9-4-5-19-8-9)10-2-3-12(17)11(6-10)13(14,15)16/h2-6,8H,7,17H2,1H3.
What are the key properties of 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine?
4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine has a molecular weight of 286.32 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-4-N-(thiophen-3-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine is sourced from PubChem (CID 43528044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).