C9H13NOS — CID 43528182
N-methyl-1-(oxiran-2-yl)-N-(thiophen-3-ylmethyl)methanamine (PubChem CID 43528182) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is N-methyl-1-(oxiran-2-yl)-N-(thiophen-3-ylmethyl)methanamine.
| Compound Name | N-methyl-1-(oxiran-2-yl)-N-(thiophen-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 43528182 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N-methyl-1-(oxiran-2-yl)-N-(thiophen-3-ylmethyl)methanamine |
| SMILES | CN(Cc1ccsc1)CC1CO1 |
| InChI | InChI=1S/C9H13NOS/c1-10(5-9-6-11-9)4-8-2-3-12-7-8/h2-3,7,9H,4-6H2,1H3 |
| InChIKey | MPKCYEPVPPFHJV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|