C16H20FNO3 — CID 43529529
1-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 43529529) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43529529 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[2-[2-(2-fluorophenyl)ethylamino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCC1)NCCc1ccccc1F |
| InChI | InChI=1S/C16H20FNO3/c17-13-6-2-1-5-12(13)7-10-18-14(19)11-16(15(20)21)8-3-4-9-16/h1-2,5-6H,3-4,7-11H2,(H,18,19)(H,20,21) |
| InChIKey | ZPIZPAGMDRHYPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |