About N-bromoacetamide
N-bromoacetamide (PubChem CID 4353) has the molecular formula C2H4BrNO
and a molecular weight of 137.96 g/mol. Its IUPAC name is N-bromoacetamide.
Molecular Properties
| Compound Name | N-bromoacetamide |
| PubChem CID | 4353 |
| Molecular Formula | C2H4BrNO |
| Molecular Weight | 137.96 g/mol |
| Exact Mass | 136.95 |
| IUPAC Name | N-bromoacetamide |
| SMILES | CC(=O)NBr |
| InChI | InChI=1S/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
| InChIKey | VBTQNRFWXBXZQR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.96 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromoacetamide?
The IUPAC name of N-bromoacetamide (CID 4353) is N-bromoacetamide.
What is the SMILES notation for N-bromoacetamide?
The canonical SMILES for N-bromoacetamide is CC(=O)NBr.
What is the InChIKey of N-bromoacetamide?
The InChIKey is VBTQNRFWXBXZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5).
What are the key properties of N-bromoacetamide?
N-bromoacetamide has a molecular weight of 137.96 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromoacetamide is sourced from PubChem (CID 4353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).