C12H18FNS — CID 43530003
[3-(butan-2-ylsulfanylmethyl)-4-fluorophenyl]methanamine (PubChem CID 43530003) has the molecular formula C12H18FNS and a molecular weight of 227.35 g/mol. Its IUPAC name is [3-(butan-2-ylsulfanylmethyl)-4-fluorophenyl]methanamine.
| Compound Name | [3-(butan-2-ylsulfanylmethyl)-4-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 43530003 |
| Molecular Formula | C12H18FNS |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [3-(butan-2-ylsulfanylmethyl)-4-fluorophenyl]methanamine |
| SMILES | CCC(C)SCc1cc(CN)ccc1F |
| InChI | InChI=1S/C12H18FNS/c1-3-9(2)15-8-11-6-10(7-14)4-5-12(11)13/h4-6,9H,3,7-8,14H2,1-2H3 |
| InChIKey | JXUMYZKIUJSZGP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |