About [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine
[4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine (PubChem CID 43530244) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine |
| PubChem CID | 43530244 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)C(Sc2ncn[nH]2)C1 |
| InChI | InChI=1S/C11H20N4S/c1-2-8-3-4-9(6-12)10(5-8)16-11-13-7-14-15-11/h7-10H,2-6,12H2,1H3,(H,13,14,15) |
| InChIKey | ZVMDHELQBOFLKX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The IUPAC name of [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine (CID 43530244) is [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine.
What is the SMILES notation for [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The canonical SMILES for [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine is CCC1CCC(CN)C(Sc2ncn[nH]2)C1.
What is the InChIKey of [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The InChIKey is ZVMDHELQBOFLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S/c1-2-8-3-4-9(6-12)10(5-8)16-11-13-7-14-15-11/h7-10H,2-6,12H2,1H3,(H,13,14,15).
What are the key properties of [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
[4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine has a molecular weight of 240.38 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine is sourced from PubChem (CID 43530244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).