About [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine
[2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine (PubChem CID 43530247) has the molecular formula C9H16N4S
and a molecular weight of 212.32 g/mol. Its IUPAC name is [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine |
| PubChem CID | 43530247 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine |
| SMILES | NCC1CCCCC1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4S/c10-5-7-3-1-2-4-8(7)14-9-11-6-12-13-9/h6-8H,1-5,10H2,(H,11,12,13) |
| InChIKey | PDTIAOAGVRUCRF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The IUPAC name of [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine (CID 43530247) is [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine.
What is the SMILES notation for [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The canonical SMILES for [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine is NCC1CCCCC1Sc1ncn[nH]1.
What is the InChIKey of [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
The InChIKey is PDTIAOAGVRUCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S/c10-5-7-3-1-2-4-8(7)14-9-11-6-12-13-9/h6-8H,1-5,10H2,(H,11,12,13).
What are the key properties of [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine?
[2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine has a molecular weight of 212.32 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclohexyl]methanamine is sourced from PubChem (CID 43530247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).