About [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine (PubChem CID 43530555) has the molecular formula C9H16N4S
and a molecular weight of 212.32 g/mol. Its IUPAC name is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine |
| PubChem CID | 43530555 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine |
| SMILES | Cn1cnnc1SC1CCCC1CN |
| InChI | InChI=1S/C9H16N4S/c1-13-6-11-12-9(13)14-8-4-2-3-7(8)5-10/h6-8H,2-5,10H2,1H3 |
| InChIKey | AXSOKRCCMSOPHS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine?
The IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine (CID 43530555) is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine.
What is the SMILES notation for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine?
The canonical SMILES for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine is Cn1cnnc1SC1CCCC1CN.
What is the InChIKey of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine?
The InChIKey is AXSOKRCCMSOPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S/c1-13-6-11-12-9(13)14-8-4-2-3-7(8)5-10/h6-8H,2-5,10H2,1H3.
What are the key properties of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine?
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine has a molecular weight of 212.32 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanamine is sourced from PubChem (CID 43530555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).