About [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine
[4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine (PubChem CID 43530558) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine |
| PubChem CID | 43530558 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine |
| SMILES | CC1CCC(CN)C(Sc2nncn2C)C1 |
| InChI | InChI=1S/C11H20N4S/c1-8-3-4-9(6-12)10(5-8)16-11-14-13-7-15(11)2/h7-10H,3-6,12H2,1-2H3 |
| InChIKey | PITHBIDFILXSMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The IUPAC name of [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine (CID 43530558) is [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine.
What is the SMILES notation for [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The canonical SMILES for [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine is CC1CCC(CN)C(Sc2nncn2C)C1.
What is the InChIKey of [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The InChIKey is PITHBIDFILXSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S/c1-8-3-4-9(6-12)10(5-8)16-11-14-13-7-15(11)2/h7-10H,3-6,12H2,1-2H3.
What are the key properties of [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
[4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine has a molecular weight of 240.38 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine is sourced from PubChem (CID 43530558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).