About [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine (PubChem CID 43530560) has the molecular formula C10H18N4S
and a molecular weight of 226.35 g/mol. Its IUPAC name is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine |
| PubChem CID | 43530560 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine |
| SMILES | Cn1cnnc1SC1CCCCC1CN |
| InChI | InChI=1S/C10H18N4S/c1-14-7-12-13-10(14)15-9-5-3-2-4-8(9)6-11/h7-9H,2-6,11H2,1H3 |
| InChIKey | LBIVFUGJKHHKCG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine (CID 43530560) is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine.
What is the SMILES notation for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The canonical SMILES for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine is Cn1cnnc1SC1CCCCC1CN.
What is the InChIKey of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
The InChIKey is LBIVFUGJKHHKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4S/c1-14-7-12-13-10(14)15-9-5-3-2-4-8(9)6-11/h7-9H,2-6,11H2,1H3.
What are the key properties of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine?
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine has a molecular weight of 226.35 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]cyclohexyl]methanamine is sourced from PubChem (CID 43530560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).