About [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine
[3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine (PubChem CID 43530646) has the molecular formula C10H10FN3S2
and a molecular weight of 255.34 g/mol. Its IUPAC name is [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine |
| PubChem CID | 43530646 |
| Molecular Formula | C10H10FN3S2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine |
| SMILES | NCc1ccc(CSc2nncs2)c(F)c1 |
| InChI | InChI=1S/C10H10FN3S2/c11-9-3-7(4-12)1-2-8(9)5-15-10-14-13-6-16-10/h1-3,6H,4-5,12H2 |
| InChIKey | RNRXQCHNYJEHIX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine?
The IUPAC name of [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine (CID 43530646) is [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine.
What is the SMILES notation for [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine?
The canonical SMILES for [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine is NCc1ccc(CSc2nncs2)c(F)c1.
What is the InChIKey of [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine?
The InChIKey is RNRXQCHNYJEHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3S2/c11-9-3-7(4-12)1-2-8(9)5-15-10-14-13-6-16-10/h1-3,6H,4-5,12H2.
What are the key properties of [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine?
[3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine has a molecular weight of 255.34 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(1,3,4-thiadiazol-2-ylsulfanylmethyl)phenyl]methanamine is sourced from PubChem (CID 43530646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).