C17H29NO3 — CID 43531590
1-[3-(aminomethyl)phenoxy]-3-heptoxypropan-2-ol (PubChem CID 43531590) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenoxy]-3-heptoxypropan-2-ol.
| Compound Name | 1-[3-(aminomethyl)phenoxy]-3-heptoxypropan-2-ol |
|---|---|
| PubChem CID | 43531590 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[3-(aminomethyl)phenoxy]-3-heptoxypropan-2-ol |
| SMILES | CCCCCCCOCC(O)COc1cccc(CN)c1 |
| InChI | InChI=1S/C17H29NO3/c1-2-3-4-5-6-10-20-13-16(19)14-21-17-9-7-8-15(11-17)12-18/h7-9,11,16,19H,2-6,10,12-14,18H2,1H3 |
| InChIKey | IREUSIIVGNFFLY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|