1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride

C11H9ClF2N2O2S — CID 43531744

IUPAC1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride
SMILESCc1nn(-c2ccc(F)cc2F)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C11H9ClF2N2O2S/c1-6-11(19(12,17)18)7(2)16(15-6)10-4-3-8(13)5-9(10)14/h3-5H,1-2H3
InChIKeyMIUUZUPTFNJBGI-UHFFFAOYSA-N
MW306.72 g/mol
LogP2.69
Rot. Bonds2

About 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride

1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (PubChem CID 43531744) has the molecular formula C11H9ClF2N2O2S and a molecular weight of 306.72 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride
PubChem CID43531744
Molecular FormulaC11H9ClF2N2O2S
Molecular Weight306.72 g/mol
Exact Mass306.00
IUPAC Name1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride
SMILESCc1nn(-c2ccc(F)cc2F)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C11H9ClF2N2O2S/c1-6-11(19(12,17)18)7(2)16(15-6)10-4-3-8(13)5-9(10)14/h3-5H,1-2H3
InChIKeyMIUUZUPTFNJBGI-UHFFFAOYSA-N
XLogP2.69
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.72
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride?
The IUPAC name of 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (CID 43531744) is 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride is Cc1nn(-c2ccc(F)cc2F)c(C)c1S(=O)(=O)Cl.
What is the InChIKey of 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride?
The InChIKey is MIUUZUPTFNJBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClF2N2O2S/c1-6-11(19(12,17)18)7(2)16(15-6)10-4-3-8(13)5-9(10)14/h3-5H,1-2H3.
What are the key properties of 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride?
1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride has a molecular weight of 306.72 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 43531744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).