C11H9ClF2N2O2S — CID 43531744
1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride (PubChem CID 43531744) has the molecular formula C11H9ClF2N2O2S and a molecular weight of 306.72 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride.
| Compound Name | 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 43531744 |
| Molecular Formula | C11H9ClF2N2O2S |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-sulfonyl chloride |
| SMILES | Cc1nn(-c2ccc(F)cc2F)c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H9ClF2N2O2S/c1-6-11(19(12,17)18)7(2)16(15-6)10-4-3-8(13)5-9(10)14/h3-5H,1-2H3 |
| InChIKey | MIUUZUPTFNJBGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |