About 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride
1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride (PubChem CID 43531775) has the molecular formula C9H15ClN2O2S
and a molecular weight of 250.75 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride |
| PubChem CID | 43531775 |
| Molecular Formula | C9H15ClN2O2S |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H15ClN2O2S/c1-6-8(15(10,13)14)7(2)12(11-6)9(3,4)5/h1-5H3 |
| InChIKey | SYPWLWGKWIMAOE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride?
The IUPAC name of 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride (CID 43531775) is 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride is Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)Cl.
What is the InChIKey of 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride?
The InChIKey is SYPWLWGKWIMAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2O2S/c1-6-8(15(10,13)14)7(2)12(11-6)9(3,4)5/h1-5H3.
What are the key properties of 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride?
1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride has a molecular weight of 250.75 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,5-dimethylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 43531775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).