About N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine
N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 43533037) has the molecular formula C10H16N4O2
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine |
| PubChem CID | 43533037 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(NC2CCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O2/c1-7-9(14(15)16)10(13(2)12-7)11-8-5-3-4-6-8/h8,11H,3-6H2,1-2H3 |
| InChIKey | QGJNDAONXAHOSI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine?
The IUPAC name of N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine (CID 43533037) is N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine.
What is the SMILES notation for N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine?
The canonical SMILES for N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine is Cc1nn(C)c(NC2CCCC2)c1[N+](=O)[O-].
What is the InChIKey of N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine?
The InChIKey is QGJNDAONXAHOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2/c1-7-9(14(15)16)10(13(2)12-7)11-8-5-3-4-6-8/h8,11H,3-6H2,1-2H3.
What are the key properties of N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine?
N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine has a molecular weight of 224.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1,3-dimethyl-4-nitropyrazol-5-amine is sourced from PubChem (CID 43533037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).