C9H9N3O5S — CID 43535072
5-[(1-methylpyrazol-4-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 43535072) has the molecular formula C9H9N3O5S and a molecular weight of 271.25 g/mol. Its IUPAC name is 5-[(1-methylpyrazol-4-yl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[(1-methylpyrazol-4-yl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43535072 |
| Molecular Formula | C9H9N3O5S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5-[(1-methylpyrazol-4-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | Cn1cc(NS(=O)(=O)c2ccc(C(=O)O)o2)cn1 |
| InChI | InChI=1S/C9H9N3O5S/c1-12-5-6(4-10-12)11-18(15,16)8-3-2-7(17-8)9(13)14/h2-5,11H,1H3,(H,13,14) |
| InChIKey | OILCLLZHFWJDHX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |