C14H13FN2O2 — CID 43535493
6-fluoro-3-[1-(furan-2-yl)ethylamino]-1,3-dihydroindol-2-one (PubChem CID 43535493) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-fluoro-3-[1-(furan-2-yl)ethylamino]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[1-(furan-2-yl)ethylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43535493 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 6-fluoro-3-[1-(furan-2-yl)ethylamino]-1,3-dihydroindol-2-one |
| SMILES | CC(NC1C(=O)Nc2cc(F)ccc21)c1ccco1 |
| InChI | InChI=1S/C14H13FN2O2/c1-8(12-3-2-6-19-12)16-13-10-5-4-9(15)7-11(10)17-14(13)18/h2-8,13,16H,1H3,(H,17,18) |
| InChIKey | JLDPTKFRVHYGLU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |