C11H14N2O3S2 — CID 43535864
5-(aminomethyl)-N-[1-(furan-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 43535864) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[1-(furan-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[1-(furan-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43535864 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5-(aminomethyl)-N-[1-(furan-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(CN)s1)c1ccco1 |
| InChI | InChI=1S/C11H14N2O3S2/c1-8(10-3-2-6-16-10)13-18(14,15)11-5-4-9(7-12)17-11/h2-6,8,13H,7,12H2,1H3 |
| InChIKey | IWJGZKIHTMPMSK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |