About 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid
2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid (PubChem CID 43535920) has the molecular formula C8H5F3N2O2S
and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid |
| PubChem CID | 43535920 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1csc2nc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C8H5F3N2O2S/c9-8(10,11)5-2-13-4(1-6(14)15)3-16-7(13)12-5/h2-3H,1H2,(H,14,15) |
| InChIKey | ICVLDOXATFVEGE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid?
The IUPAC name of 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid (CID 43535920) is 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid?
The canonical SMILES for 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid is O=C(O)Cc1csc2nc(C(F)(F)F)cn12.
What is the InChIKey of 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid?
The InChIKey is ICVLDOXATFVEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O2S/c9-8(10,11)5-2-13-4(1-6(14)15)3-16-7(13)12-5/h2-3H,1H2,(H,14,15).
What are the key properties of 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid?
2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid has a molecular weight of 250.20 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(trifluoromethyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid is sourced from PubChem (CID 43535920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).