About 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid
3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid (PubChem CID 43536316) has the molecular formula C6H8N2O2S2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid.
Molecular Properties
| Compound Name | 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid |
| PubChem CID | 43536316 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid |
| SMILES | CC(CC(=O)O)Sc1nncs1 |
| InChI | InChI=1S/C6H8N2O2S2/c1-4(2-5(9)10)12-6-8-7-3-11-6/h3-4H,2H2,1H3,(H,9,10) |
| InChIKey | IBJDVSBVYZBVFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid?
The IUPAC name of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid (CID 43536316) is 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid.
What is the SMILES notation for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid?
The canonical SMILES for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid is CC(CC(=O)O)Sc1nncs1.
What is the InChIKey of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid?
The InChIKey is IBJDVSBVYZBVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S2/c1-4(2-5(9)10)12-6-8-7-3-11-6/h3-4H,2H2,1H3,(H,9,10).
What are the key properties of 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid?
3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid has a molecular weight of 204.28 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoic acid is sourced from PubChem (CID 43536316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).