methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate

C7H10N2O2S2 — CID 43536317

IUPACmethyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate
SMILESCOC(=O)CC(C)Sc1nncs1
InChIInChI=1S/C7H10N2O2S2/c1-5(3-6(10)11-2)13-7-9-8-4-12-7/h4-5H,3H2,1-2H3
InChIKeyZAHVOMOQRHJTAF-UHFFFAOYSA-N
MW218.30 g/mol
LogP1.58
Rot. Bonds4

About methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate

methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate (PubChem CID 43536317) has the molecular formula C7H10N2O2S2 and a molecular weight of 218.30 g/mol. Its IUPAC name is methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate.

Molecular Properties

Compound Namemethyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate
PubChem CID43536317
Molecular FormulaC7H10N2O2S2
Molecular Weight218.30 g/mol
Exact Mass218.02
IUPAC Namemethyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate
SMILESCOC(=O)CC(C)Sc1nncs1
InChIInChI=1S/C7H10N2O2S2/c1-5(3-6(10)11-2)13-7-9-8-4-12-7/h4-5H,3H2,1-2H3
InChIKeyZAHVOMOQRHJTAF-UHFFFAOYSA-N
XLogP1.58
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.30
LogP ≤ 51.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate?
The IUPAC name of methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate (CID 43536317) is methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate.
What is the SMILES notation for methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate?
The canonical SMILES for methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate is COC(=O)CC(C)Sc1nncs1.
What is the InChIKey of methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate?
The InChIKey is ZAHVOMOQRHJTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S2/c1-5(3-6(10)11-2)13-7-9-8-4-12-7/h4-5H,3H2,1-2H3.
What are the key properties of methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate?
methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate has a molecular weight of 218.30 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,3,4-thiadiazol-2-ylsulfanyl)butanoate is sourced from PubChem (CID 43536317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).