About 3-(diethylamino)butanoic acid
3-(diethylamino)butanoic acid (PubChem CID 43537230) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(diethylamino)butanoic acid.
Molecular Properties
| Compound Name | 3-(diethylamino)butanoic acid |
| PubChem CID | 43537230 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3-(diethylamino)butanoic acid |
| SMILES | CCN(CC)C(C)CC(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-4-9(5-2)7(3)6-8(10)11/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | CIXVSNIDDROFGR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(diethylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)butanoic acid?
The IUPAC name of 3-(diethylamino)butanoic acid (CID 43537230) is 3-(diethylamino)butanoic acid.
What is the SMILES notation for 3-(diethylamino)butanoic acid?
The canonical SMILES for 3-(diethylamino)butanoic acid is CCN(CC)C(C)CC(=O)O.
What is the InChIKey of 3-(diethylamino)butanoic acid?
The InChIKey is CIXVSNIDDROFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-4-9(5-2)7(3)6-8(10)11/h7H,4-6H2,1-3H3,(H,10,11).
What are the key properties of 3-(diethylamino)butanoic acid?
3-(diethylamino)butanoic acid has a molecular weight of 159.23 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)butanoic acid is sourced from PubChem (CID 43537230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).