About 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine
6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43539052) has the molecular formula C13H18FNO2S
and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 43539052 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCCNC1CC(C)S(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H18FNO2S/c1-3-6-15-12-7-9(2)18(16,17)13-5-4-10(14)8-11(12)13/h4-5,8-9,12,15H,3,6-7H2,1-2H3 |
| InChIKey | YKJPJILKAPDFGS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine (CID 43539052) is 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine is CCCNC1CC(C)S(=O)(=O)c2ccc(F)cc21.
What is the InChIKey of 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is YKJPJILKAPDFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO2S/c1-3-6-15-12-7-9(2)18(16,17)13-5-4-10(14)8-11(12)13/h4-5,8-9,12,15H,3,6-7H2,1-2H3.
What are the key properties of 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine?
6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 271.36 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-1,1-dioxo-N-propyl-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 43539052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).