C13H19NO2S — CID 43539225
N,7,8-trimethyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-amine (PubChem CID 43539225) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N,7,8-trimethyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-amine.
| Compound Name | N,7,8-trimethyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-amine |
|---|---|
| PubChem CID | 43539225 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N,7,8-trimethyl-1,1-dioxo-2,3,4,5-tetrahydro-1λ6-benzothiepin-5-amine |
| SMILES | CNC1CCCS(=O)(=O)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C13H19NO2S/c1-9-7-11-12(14-3)5-4-6-17(15,16)13(11)8-10(9)2/h7-8,12,14H,4-6H2,1-3H3 |
| InChIKey | UEIANTGJEJHQGS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |