About 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine
7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 43539433) has the molecular formula C10H12BrNS
and a molecular weight of 258.18 g/mol. Its IUPAC name is 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 43539433 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCNC1CSc2c(Br)cccc21 |
| InChI | InChI=1S/C10H12BrNS/c1-2-12-9-6-13-10-7(9)4-3-5-8(10)11/h3-5,9,12H,2,6H2,1H3 |
| InChIKey | AMIBBDFKWXOXTO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine (CID 43539433) is 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine is CCNC1CSc2c(Br)cccc21.
What is the InChIKey of 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is AMIBBDFKWXOXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNS/c1-2-12-9-6-13-10-7(9)4-3-5-8(10)11/h3-5,9,12H,2,6H2,1H3.
What are the key properties of 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine?
7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 258.18 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N-ethyl-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 43539433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).