About 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine
6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 43539490) has the molecular formula C11H14BrNS
and a molecular weight of 272.21 g/mol. Its IUPAC name is 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 43539490 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CCNC1CCSc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H14BrNS/c1-2-13-10-5-6-14-11-4-3-8(12)7-9(10)11/h3-4,7,10,13H,2,5-6H2,1H3 |
| InChIKey | RPXFUNFOAAVJPC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine (CID 43539490) is 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine is CCNC1CCSc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is RPXFUNFOAAVJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNS/c1-2-13-10-5-6-14-11-4-3-8(12)7-9(10)11/h3-4,7,10,13H,2,5-6H2,1H3.
What are the key properties of 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine?
6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 272.21 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-ethyl-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 43539490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).