About N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine
N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 43539577) has the molecular formula C10H11F2NS
and a molecular weight of 215.27 g/mol. Its IUPAC name is N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 43539577 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCNC1CSc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C10H11F2NS/c1-2-13-8-5-14-10-7(12)4-3-6(11)9(8)10/h3-4,8,13H,2,5H2,1H3 |
| InChIKey | GXLUQOCYZNWIHQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine (CID 43539577) is N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine is CCNC1CSc2c(F)ccc(F)c21.
What is the InChIKey of N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is GXLUQOCYZNWIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NS/c1-2-13-8-5-14-10-7(12)4-3-6(11)9(8)10/h3-4,8,13H,2,5H2,1H3.
What are the key properties of N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine?
N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 215.27 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,7-difluoro-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 43539577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).