C17H24N2O — CID 43541045
1-(1-benzofuran-2-yl)-N'-cyclopentyl-N'-ethylethane-1,2-diamine (PubChem CID 43541045) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-N'-cyclopentyl-N'-ethylethane-1,2-diamine.
| Compound Name | 1-(1-benzofuran-2-yl)-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43541045 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CC(N)c1cc2ccccc2o1)C1CCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-2-19(14-8-4-5-9-14)12-15(18)17-11-13-7-3-6-10-16(13)20-17/h3,6-7,10-11,14-15H,2,4-5,8-9,12,18H2,1H3 |
| InChIKey | QXILSCQHLLEWHO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |