C17H28N2O — CID 43541063
N'-cyclopentyl-1-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine (PubChem CID 43541063) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N'-cyclopentyl-1-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-cyclopentyl-1-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43541063 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N'-cyclopentyl-1-(4-ethoxyphenyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCOc1ccc(C(N)CN(CC)C2CCCC2)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-3-19(15-7-5-6-8-15)13-17(18)14-9-11-16(12-10-14)20-4-2/h9-12,15,17H,3-8,13,18H2,1-2H3 |
| InChIKey | APSVXDOGFJFJOT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |