C17H21ClN2 — CID 43541407
3-(chloromethyl)-N-cyclopentyl-N-ethylquinolin-2-amine (PubChem CID 43541407) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 3-(chloromethyl)-N-cyclopentyl-N-ethylquinolin-2-amine.
| Compound Name | 3-(chloromethyl)-N-cyclopentyl-N-ethylquinolin-2-amine |
|---|---|
| PubChem CID | 43541407 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-(chloromethyl)-N-cyclopentyl-N-ethylquinolin-2-amine |
| SMILES | CCN(c1nc2ccccc2cc1CCl)C1CCCC1 |
| InChI | InChI=1S/C17H21ClN2/c1-2-20(15-8-4-5-9-15)17-14(12-18)11-13-7-3-6-10-16(13)19-17/h3,6-7,10-11,15H,2,4-5,8-9,12H2,1H3 |
| InChIKey | QWGNGSBVACUTGI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|