C16H13BrN2O2 — CID 43542683
1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)pyrazole-4-carbaldehyde (PubChem CID 43542683) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 43542683 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,5-dimethylfuran-3-yl)pyrazole-4-carbaldehyde |
| SMILES | Cc1cc(-c2nn(-c3cccc(Br)c3)cc2C=O)c(C)o1 |
| InChI | InChI=1S/C16H13BrN2O2/c1-10-6-15(11(2)21-10)16-12(9-20)8-19(18-16)14-5-3-4-13(17)7-14/h3-9H,1-2H3 |
| InChIKey | KZLXNTZTQQAKAN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|