C14H20N2O3 — CID 43544460
6-(2,5-dimethylmorpholin-4-yl)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 43544460) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(2,5-dimethylmorpholin-4-yl)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(2,5-dimethylmorpholin-4-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 43544460 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-(2,5-dimethylmorpholin-4-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CC1CN(c2cc3c(cc2N)OCCO3)C(C)CO1 |
| InChI | InChI=1S/C14H20N2O3/c1-9-8-19-10(2)7-16(9)12-6-14-13(5-11(12)15)17-3-4-18-14/h5-6,9-10H,3-4,7-8,15H2,1-2H3 |
| InChIKey | UXCLPXMCZVXPTE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|