About 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide
4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide (PubChem CID 43544825) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide.
Molecular Properties
| Compound Name | 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide |
| PubChem CID | 43544825 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide |
| SMILES | CC1CN(C(=O)COc2ccc(C(N)=S)cc2)C(C)CO1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10-8-19-11(2)7-17(10)14(18)9-20-13-5-3-12(4-6-13)15(16)21/h3-6,10-11H,7-9H2,1-2H3,(H2,16,21) |
| InChIKey | LMBUGKQZSDNWRJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide?
The IUPAC name of 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide (CID 43544825) is 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide.
What is the SMILES notation for 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide?
The canonical SMILES for 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide is CC1CN(C(=O)COc2ccc(C(N)=S)cc2)C(C)CO1.
What is the InChIKey of 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide?
The InChIKey is LMBUGKQZSDNWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-10-8-19-11(2)7-17(10)14(18)9-20-13-5-3-12(4-6-13)15(16)21/h3-6,10-11H,7-9H2,1-2H3,(H2,16,21).
What are the key properties of 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide?
4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide has a molecular weight of 308.40 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethoxy]benzenecarbothioamide is sourced from PubChem (CID 43544825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).