C16H24N2O — CID 43544881
N-[[4-(2,5-dimethylmorpholin-4-yl)phenyl]methyl]cyclopropanamine (PubChem CID 43544881) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-[[4-(2,5-dimethylmorpholin-4-yl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(2,5-dimethylmorpholin-4-yl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43544881 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-[[4-(2,5-dimethylmorpholin-4-yl)phenyl]methyl]cyclopropanamine |
| SMILES | CC1CN(c2ccc(CNC3CC3)cc2)C(C)CO1 |
| InChI | InChI=1S/C16H24N2O/c1-12-11-19-13(2)10-18(12)16-7-3-14(4-8-16)9-17-15-5-6-15/h3-4,7-8,12-13,15,17H,5-6,9-11H2,1-2H3 |
| InChIKey | XVRVVTDVBBPQLT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|