About 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide
3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide (PubChem CID 43544975) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide.
Molecular Properties
| Compound Name | 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide |
| PubChem CID | 43544975 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide |
| SMILES | CC1CN(C(=O)C/C(N)=N/O)C(C)CO1 |
| InChI | InChI=1S/C9H17N3O3/c1-6-5-15-7(2)4-12(6)9(13)3-8(10)11-14/h6-7,14H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | DBHKTSHBMKSQDB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The IUPAC name of 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide (CID 43544975) is 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide.
What is the SMILES notation for 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The canonical SMILES for 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide is CC1CN(C(=O)C/C(N)=N/O)C(C)CO1.
What is the InChIKey of 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide?
The InChIKey is DBHKTSHBMKSQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-6-5-15-7(2)4-12(6)9(13)3-8(10)11-14/h6-7,14H,3-5H2,1-2H3,(H2,10,11).
What are the key properties of 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide?
3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide has a molecular weight of 215.25 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylmorpholin-4-yl)-N'-hydroxy-3-oxopropanimidamide is sourced from PubChem (CID 43544975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).