C15H19Cl2FN2 — CID 43545077
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43545077) has the molecular formula C15H19Cl2FN2 and a molecular weight of 317.24 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43545077 |
| Molecular Formula | C15H19Cl2FN2 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CC(NC1CN2CCC1CC2)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H19Cl2FN2/c1-9(14-11(16)2-3-12(18)15(14)17)19-13-8-20-6-4-10(13)5-7-20/h2-3,9-10,13,19H,4-8H2,1H3 |
| InChIKey | ZXFZUESJBLQPCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|