C6H12N4O3 — CID 43545817
(3Z)-3-amino-N-(1-amino-1-oxopropan-2-yl)-3-hydroxyiminopropanamide (PubChem CID 43545817) has the molecular formula C6H12N4O3 and a molecular weight of 188.19 g/mol. Its IUPAC name is (3Z)-3-amino-N-(1-amino-1-oxopropan-2-yl)-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N-(1-amino-1-oxopropan-2-yl)-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 43545817 |
| Molecular Formula | C6H12N4O3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (3Z)-3-amino-N-(1-amino-1-oxopropan-2-yl)-3-hydroxyiminopropanamide |
| SMILES | CC(NC(=O)C/C(N)=N/O)C(N)=O |
| InChI | InChI=1S/C6H12N4O3/c1-3(6(8)12)9-5(11)2-4(7)10-13/h3,13H,2H2,1H3,(H2,7,10)(H2,8,12)(H,9,11) |
| InChIKey | SGGXJAVUAKKYLY-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|