C10H13N5O2S2 — CID 43546210
N-[2-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]methanesulfonamide (PubChem CID 43546210) has the molecular formula C10H13N5O2S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[2-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43546210 |
| Molecular Formula | C10H13N5O2S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[2-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCn1c(-c2ccncc2)n[nH]c1=S |
| InChI | InChI=1S/C10H13N5O2S2/c1-19(16,17)12-6-7-15-9(13-14-10(15)18)8-2-4-11-5-3-8/h2-5,12H,6-7H2,1H3,(H,14,18) |
| InChIKey | IFTVJYSZTQJCIL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|