About 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide
5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide (PubChem CID 43547052) has the molecular formula C11H12ClFN4O2S
and a molecular weight of 318.76 g/mol. Its IUPAC name is 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide |
| PubChem CID | 43547052 |
| Molecular Formula | C11H12ClFN4O2S |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1cc(N)cc(Cl)c1F |
| InChI | InChI=1S/C11H12ClFN4O2S/c1-5-11(6(2)16-15-5)17-20(18,19)9-4-7(14)3-8(12)10(9)13/h3-4,17H,14H2,1-2H3,(H,15,16) |
| InChIKey | LZFGCKKHHCFJKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide?
The IUPAC name of 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide (CID 43547052) is 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide.
What is the SMILES notation for 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide?
The canonical SMILES for 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide is Cc1n[nH]c(C)c1NS(=O)(=O)c1cc(N)cc(Cl)c1F.
What is the InChIKey of 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide?
The InChIKey is LZFGCKKHHCFJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFN4O2S/c1-5-11(6(2)16-15-5)17-20(18,19)9-4-7(14)3-8(12)10(9)13/h3-4,17H,14H2,1-2H3,(H,15,16).
What are the key properties of 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide?
5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide has a molecular weight of 318.76 g/mol, XLogP of 2.20, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide is sourced from PubChem (CID 43547052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).