C11H12ClFN4O2S — CID 43547052
5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide (PubChem CID 43547052) has the molecular formula C11H12ClFN4O2S and a molecular weight of 318.76 g/mol. Its IUPAC name is 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 43547052 |
| Molecular Formula | C11H12ClFN4O2S |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-amino-3-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-fluorobenzenesulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1cc(N)cc(Cl)c1F |
| InChI | InChI=1S/C11H12ClFN4O2S/c1-5-11(6(2)16-15-5)17-20(18,19)9-4-7(14)3-8(12)10(9)13/h3-4,17H,14H2,1-2H3,(H,15,16) |
| InChIKey | LZFGCKKHHCFJKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|