C16H23N3 — CID 43547100
N-[1-(4-ethylphenyl)propyl]-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 43547100) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)propyl]-3,5-dimethyl-1H-pyrazol-4-amine.
| Compound Name | N-[1-(4-ethylphenyl)propyl]-3,5-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43547100 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-[1-(4-ethylphenyl)propyl]-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | CCc1ccc(C(CC)Nc2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C16H23N3/c1-5-13-7-9-14(10-8-13)15(6-2)17-16-11(3)18-19-12(16)4/h7-10,15,17H,5-6H2,1-4H3,(H,18,19) |
| InChIKey | HJTQRQGSCAPQLB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |