About N-butyl-3,5-dimethyl-1H-pyrazol-4-amine
N-butyl-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 43547243) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N-butyl-3,5-dimethyl-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | N-butyl-3,5-dimethyl-1H-pyrazol-4-amine |
| PubChem CID | 43547243 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-butyl-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | CCCCNc1c(C)n[nH]c1C |
| InChI | InChI=1S/C9H17N3/c1-4-5-6-10-9-7(2)11-12-8(9)3/h10H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | COCXXKDDRSZRMV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-3,5-dimethyl-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3,5-dimethyl-1H-pyrazol-4-amine?
The IUPAC name of N-butyl-3,5-dimethyl-1H-pyrazol-4-amine (CID 43547243) is N-butyl-3,5-dimethyl-1H-pyrazol-4-amine.
What is the SMILES notation for N-butyl-3,5-dimethyl-1H-pyrazol-4-amine?
The canonical SMILES for N-butyl-3,5-dimethyl-1H-pyrazol-4-amine is CCCCNc1c(C)n[nH]c1C.
What is the InChIKey of N-butyl-3,5-dimethyl-1H-pyrazol-4-amine?
The InChIKey is COCXXKDDRSZRMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-4-5-6-10-9-7(2)11-12-8(9)3/h10H,4-6H2,1-3H3,(H,11,12).
What are the key properties of N-butyl-3,5-dimethyl-1H-pyrazol-4-amine?
N-butyl-3,5-dimethyl-1H-pyrazol-4-amine has a molecular weight of 167.26 g/mol, XLogP of 2.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3,5-dimethyl-1H-pyrazol-4-amine is sourced from PubChem (CID 43547243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).