About 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid
2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 43547665) has the molecular formula C11H13N3O4S2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid |
| PubChem CID | 43547665 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-6-11(7(2)13-12-6)14-20(17,18)10-4-3-8(19-10)5-9(15)16/h3-4,14H,5H2,1-2H3,(H,12,13)(H,15,16) |
| InChIKey | KATWRIZNCKOAJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid?
The IUPAC name of 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid (CID 43547665) is 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid.
What is the SMILES notation for 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid?
The canonical SMILES for 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid is Cc1n[nH]c(C)c1NS(=O)(=O)c1ccc(CC(=O)O)s1.
What is the InChIKey of 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid?
The InChIKey is KATWRIZNCKOAJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O4S2/c1-6-11(7(2)13-12-6)14-20(17,18)10-4-3-8(19-10)5-9(15)16/h3-4,14H,5H2,1-2H3,(H,12,13)(H,15,16).
What are the key properties of 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid?
2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid has a molecular weight of 315.38 g/mol, XLogP of 1.52, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophen-2-yl]acetic acid is sourced from PubChem (CID 43547665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).