About 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide
2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 43547704) has the molecular formula C8H9ClN4O2S2
and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 43547704 |
| Molecular Formula | C8H9ClN4O2S2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C8H9ClN4O2S2/c1-4-7(5(2)12-11-4)13-17(14,15)6-3-10-8(9)16-6/h3,13H,1-2H3,(H,11,12) |
| InChIKey | IRYYJUXTJPGIRP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide (CID 43547704) is 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide is Cc1n[nH]c(C)c1NS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide?
The InChIKey is IRYYJUXTJPGIRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4O2S2/c1-4-7(5(2)12-11-4)13-17(14,15)6-3-10-8(9)16-6/h3,13H,1-2H3,(H,11,12).
What are the key properties of 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide?
2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide has a molecular weight of 292.77 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 43547704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).