About 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide
2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide (PubChem CID 43547722) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide.
Molecular Properties
| Compound Name | 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide |
| PubChem CID | 43547722 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C11H20N4O/c1-6(2)5-9(12)11(16)13-10-7(3)14-15-8(10)4/h6,9H,5,12H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | OUXJXKCOPDSPQN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide?
The IUPAC name of 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide (CID 43547722) is 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide.
What is the SMILES notation for 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide?
The canonical SMILES for 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide is Cc1n[nH]c(C)c1NC(=O)C(N)CC(C)C.
What is the InChIKey of 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide?
The InChIKey is OUXJXKCOPDSPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-6(2)5-9(12)11(16)13-10-7(3)14-15-8(10)4/h6,9H,5,12H2,1-4H3,(H,13,16)(H,14,15).
What are the key properties of 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide?
2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide has a molecular weight of 224.31 g/mol, XLogP of 1.34, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylpentanamide is sourced from PubChem (CID 43547722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).