C15H15BrN2O3 — CID 43549583
N-(4-amino-2-bromophenyl)-3,5-dimethoxybenzamide (PubChem CID 43549583) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(4-amino-2-bromophenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 43549583 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N)cc2Br)c1 |
| InChI | InChI=1S/C15H15BrN2O3/c1-20-11-5-9(6-12(8-11)21-2)15(19)18-14-4-3-10(17)7-13(14)16/h3-8H,17H2,1-2H3,(H,18,19) |
| InChIKey | BMJGNTXCKWTLND-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|